C18H34BaO3Zn — CID 175884069
CID 175884069 (PubChem CID 175884069) has the molecular formula C18H34BaO3Zn and a molecular weight of 501.19 g/mol.
| Compound Name | CID 175884069 |
|---|---|
| PubChem CID | 175884069 |
| Molecular Formula | C18H34BaO3Zn |
| Molecular Weight | 501.19 g/mol |
| Exact Mass | 500.09 |
| IUPAC Name | — |
| SMILES | CCCCCC[C@@H](O)C/C=C\CCCCCCCC(=O)O.[Ba].[Zn] |
| InChI | InChI=1S/C18H34O3.Ba.Zn/c1-2-3-4-11-14-17(19)15-12-9-7-5-6-8-10-13-16-18(20)21;;/h9,12,17,19H,2-8,10-11,13-16H2,1H3,(H,20,21);;/b12-9-;;/t17-;;/m1../s1 |
| InChIKey | UXPGCBXRHKHMQQ-GKKIQAINSA-N |
| XLogP | 4.70 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.19 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|