C22H40O3 — CID 139805405
4-hydroxydocosa-9,13-dienoic acid (PubChem CID 139805405) has the molecular formula C22H40O3 and a molecular weight of 352.56 g/mol. Its IUPAC name is 4-hydroxydocosa-9,13-dienoic acid.
| Compound Name | 4-hydroxydocosa-9,13-dienoic acid |
|---|---|
| PubChem CID | 139805405 |
| Molecular Formula | C22H40O3 |
| Molecular Weight | 352.56 g/mol |
| Exact Mass | 352.30 |
| IUPAC Name | 4-hydroxydocosa-9,13-dienoic acid |
| SMILES | CCCCCCCCC=CCCC=CCCCCC(O)CCC(=O)O |
| InChI | InChI=1S/C22H40O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-21(23)19-20-22(24)25/h9-10,13-14,21,23H,2-8,11-12,15-20H2,1H3,(H,24,25) |
| InChIKey | ZMOVLBBFASMRRI-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.56 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|