C22H35NO4 — CID 173492249
(7Z,10Z,13Z,16Z)-5-hydroxy-4-nitrodocosa-7,10,13,16-tetraenal (PubChem CID 173492249) has the molecular formula C22H35NO4 and a molecular weight of 377.53 g/mol. Its IUPAC name is (7Z,10Z,13Z,16Z)-5-hydroxy-4-nitrodocosa-7,10,13,16-tetraenal.
| Compound Name | (7Z,10Z,13Z,16Z)-5-hydroxy-4-nitrodocosa-7,10,13,16-tetraenal |
|---|---|
| PubChem CID | 173492249 |
| Molecular Formula | C22H35NO4 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.26 |
| IUPAC Name | (7Z,10Z,13Z,16Z)-5-hydroxy-4-nitrodocosa-7,10,13,16-tetraenal |
| SMILES | CCCCC/C=C\C/C=C\C/C=C\C/C=C\CC(O)C(CCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C22H35NO4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-19-22(25)21(23(26)27)18-17-20-24/h6-7,9-10,12-13,15-16,20-22,25H,2-5,8,11,14,17-19H2,1H3/b7-6-,10-9-,13-12-,16-15- |
| InChIKey | RQHJOGVPQCEVQQ-DOFZRALJSA-N |
| XLogP | 5.34 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|