C18H31NO4 — CID 173492009
(12Z,15Z)-9-hydroxy-10-nitrooctadeca-12,15-dienal (PubChem CID 173492009) has the molecular formula C18H31NO4 and a molecular weight of 325.45 g/mol. Its IUPAC name is (12Z,15Z)-9-hydroxy-10-nitrooctadeca-12,15-dienal.
| Compound Name | (12Z,15Z)-9-hydroxy-10-nitrooctadeca-12,15-dienal |
|---|---|
| PubChem CID | 173492009 |
| Molecular Formula | C18H31NO4 |
| Molecular Weight | 325.45 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | (12Z,15Z)-9-hydroxy-10-nitrooctadeca-12,15-dienal |
| SMILES | CC/C=C\C/C=C\CC(C(O)CCCCCCCC=O)[N+](=O)[O-] |
| InChI | InChI=1S/C18H31NO4/c1-2-3-4-5-8-11-14-17(19(22)23)18(21)15-12-9-6-7-10-13-16-20/h3-4,8,11,16-18,21H,2,5-7,9-10,12-15H2,1H3/b4-3-,11-8- |
| InChIKey | ZUQMKIZQWZTYHS-MLQKXRJWSA-N |
| XLogP | 4.22 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.45 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|