C20H33NO5 — CID 101152121
(5Z,8Z,14Z)-12-hydroxy-11-nitroicosa-5,8,14-trienoic acid (PubChem CID 101152121) has the molecular formula C20H33NO5 and a molecular weight of 367.49 g/mol. Its IUPAC name is (5Z,8Z,14Z)-12-hydroxy-11-nitroicosa-5,8,14-trienoic acid.
| Compound Name | (5Z,8Z,14Z)-12-hydroxy-11-nitroicosa-5,8,14-trienoic acid |
|---|---|
| PubChem CID | 101152121 |
| Molecular Formula | C20H33NO5 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.24 |
| IUPAC Name | (5Z,8Z,14Z)-12-hydroxy-11-nitroicosa-5,8,14-trienoic acid |
| SMILES | CCCCC/C=C\CC(O)C(C/C=C\C/C=C\CCCC(=O)O)[N+](=O)[O-] |
| InChI | InChI=1S/C20H33NO5/c1-2-3-4-5-10-13-16-19(22)18(21(25)26)15-12-9-7-6-8-11-14-17-20(23)24/h6,8-10,12-13,18-19,22H,2-5,7,11,14-17H2,1H3,(H,23,24)/b8-6-,12-9-,13-10- |
| InChIKey | GCYWUAUMMILJCP-KROJNAHFSA-N |
| XLogP | 4.67 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|