C18H32N2O7 — CID 90092302
(Z)-13,16-dihydroxy-12,15-dinitrooctadec-9-enal (PubChem CID 90092302) has the molecular formula C18H32N2O7 and a molecular weight of 388.46 g/mol. Its IUPAC name is (Z)-13,16-dihydroxy-12,15-dinitrooctadec-9-enal.
| Compound Name | (Z)-13,16-dihydroxy-12,15-dinitrooctadec-9-enal |
|---|---|
| PubChem CID | 90092302 |
| Molecular Formula | C18H32N2O7 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.22 |
| IUPAC Name | (Z)-13,16-dihydroxy-12,15-dinitrooctadec-9-enal |
| SMILES | CCC(O)C(CC(O)C(C/C=C\CCCCCCCC=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C18H32N2O7/c1-2-17(22)16(20(26)27)14-18(23)15(19(24)25)12-10-8-6-4-3-5-7-9-11-13-21/h8,10,13,15-18,22-23H,2-7,9,11-12,14H2,1H3/b10-8- |
| InChIKey | MFXLOXWIIHHWOZ-NTMALXAHSA-N |
| XLogP | 2.67 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|