C20H36N2O7 — CID 90092113
(Z)-8,14-dihydroxy-9,15-dinitroicos-11-enal (PubChem CID 90092113) has the molecular formula C20H36N2O7 and a molecular weight of 416.52 g/mol. Its IUPAC name is (Z)-8,14-dihydroxy-9,15-dinitroicos-11-enal.
| Compound Name | (Z)-8,14-dihydroxy-9,15-dinitroicos-11-enal |
|---|---|
| PubChem CID | 90092113 |
| Molecular Formula | C20H36N2O7 |
| Molecular Weight | 416.52 g/mol |
| Exact Mass | 416.25 |
| IUPAC Name | (Z)-8,14-dihydroxy-9,15-dinitroicos-11-enal |
| SMILES | CCCCCC(C(O)C/C=C\CC(C(O)CCCCCCC=O)[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C20H36N2O7/c1-2-3-7-12-17(21(26)27)20(25)15-10-9-13-18(22(28)29)19(24)14-8-5-4-6-11-16-23/h9-10,16-20,24-25H,2-8,11-15H2,1H3/b10-9- |
| InChIKey | FVPWIFNMKMHECI-KTKRTIGZSA-N |
| XLogP | 3.45 |
| TPSA | 143.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.52 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|