C20H39N3O9 — CID 141354802
6,9,12-trinitroicosane-7,10,13-triol (PubChem CID 141354802) has the molecular formula C20H39N3O9 and a molecular weight of 465.54 g/mol. Its IUPAC name is 6,9,12-trinitroicosane-7,10,13-triol.
| Compound Name | 6,9,12-trinitroicosane-7,10,13-triol |
|---|---|
| PubChem CID | 141354802 |
| Molecular Formula | C20H39N3O9 |
| Molecular Weight | 465.54 g/mol |
| Exact Mass | 465.27 |
| IUPAC Name | 6,9,12-trinitroicosane-7,10,13-triol |
| SMILES | CCCCCCCC(O)C(CC(O)C(CC(O)C(CCCCC)[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C20H39N3O9/c1-3-5-7-8-10-12-18(24)16(22(29)30)13-20(26)17(23(31)32)14-19(25)15(21(27)28)11-9-6-4-2/h15-20,24-26H,3-14H2,1-2H3 |
| InChIKey | PVWKQLNLDCYWLZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 190.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.54 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|