About 2-nitrodecan-3-ol
2-nitrodecan-3-ol (PubChem CID 11629807) has the molecular formula C10H21NO3
and a molecular weight of 203.28 g/mol. Its IUPAC name is 2-nitrodecan-3-ol.
Molecular Properties
| Compound Name | 2-nitrodecan-3-ol |
| PubChem CID | 11629807 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | 2-nitrodecan-3-ol |
| SMILES | CCCCCCCC(O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C10H21NO3/c1-3-4-5-6-7-8-10(12)9(2)11(13)14/h9-10,12H,3-8H2,1-2H3 |
| InChIKey | QADJRBMRBIAWFT-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrodecan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrodecan-3-ol?
The IUPAC name of 2-nitrodecan-3-ol (CID 11629807) is 2-nitrodecan-3-ol.
What is the SMILES notation for 2-nitrodecan-3-ol?
The canonical SMILES for 2-nitrodecan-3-ol is CCCCCCCC(O)C(C)[N+](=O)[O-].
What is the InChIKey of 2-nitrodecan-3-ol?
The InChIKey is QADJRBMRBIAWFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO3/c1-3-4-5-6-7-8-10(12)9(2)11(13)14/h9-10,12H,3-8H2,1-2H3.
What are the key properties of 2-nitrodecan-3-ol?
2-nitrodecan-3-ol has a molecular weight of 203.28 g/mol, XLogP of 2.37, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrodecan-3-ol is sourced from PubChem (CID 11629807), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).