C8H17NO4 — CID 15203325
(2R,3S)-2-nitrooctane-1,3-diol (PubChem CID 15203325) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is (2R,3S)-2-nitrooctane-1,3-diol.
| Compound Name | (2R,3S)-2-nitrooctane-1,3-diol |
|---|---|
| PubChem CID | 15203325 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | (2R,3S)-2-nitrooctane-1,3-diol |
| SMILES | CCCCC[C@H](O)[C@@H](CO)[N+](=O)[O-] |
| InChI | InChI=1S/C8H17NO4/c1-2-3-4-5-8(11)7(6-10)9(12)13/h7-8,10-11H,2-6H2,1H3/t7-,8+/m1/s1 |
| InChIKey | LFHNMWRIHDDDBR-SFYZADRCSA-N |
| XLogP | 0.57 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|