C20H37N3O10 — CID 90092230
5,9,12-trihydroxy-6,8,11-trinitroicosanal (PubChem CID 90092230) has the molecular formula C20H37N3O10 and a molecular weight of 479.53 g/mol. Its IUPAC name is 5,9,12-trihydroxy-6,8,11-trinitroicosanal.
| Compound Name | 5,9,12-trihydroxy-6,8,11-trinitroicosanal |
|---|---|
| PubChem CID | 90092230 |
| Molecular Formula | C20H37N3O10 |
| Molecular Weight | 479.53 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | 5,9,12-trihydroxy-6,8,11-trinitroicosanal |
| SMILES | CCCCCCCCC(O)C(CC(O)C(CC(C(O)CCCC=O)[N+](=O)[O-])[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C20H37N3O10/c1-2-3-4-5-6-7-10-19(26)17(23(32)33)14-20(27)16(22(30)31)13-15(21(28)29)18(25)11-8-9-12-24/h12,15-20,25-27H,2-11,13-14H2,1H3 |
| InChIKey | SPXIOQBJLAHDPH-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 207.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.53 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|