About (3R)-2-nitroheptan-3-ol
(3R)-2-nitroheptan-3-ol (PubChem CID 57225952) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is (3R)-2-nitroheptan-3-ol.
Molecular Properties
| Compound Name | (3R)-2-nitroheptan-3-ol |
| PubChem CID | 57225952 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | (3R)-2-nitroheptan-3-ol |
| SMILES | CCCC[C@@H](O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C7H15NO3/c1-3-4-5-7(9)6(2)8(10)11/h6-7,9H,3-5H2,1-2H3/t6?,7-/m1/s1 |
| InChIKey | BJKHKPOTYLELSH-COBSHVIPSA-N |
| XLogP | 1.20 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3R)-2-nitroheptan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-2-nitroheptan-3-ol?
The IUPAC name of (3R)-2-nitroheptan-3-ol (CID 57225952) is (3R)-2-nitroheptan-3-ol.
What is the SMILES notation for (3R)-2-nitroheptan-3-ol?
The canonical SMILES for (3R)-2-nitroheptan-3-ol is CCCC[C@@H](O)C(C)[N+](=O)[O-].
What is the InChIKey of (3R)-2-nitroheptan-3-ol?
The InChIKey is BJKHKPOTYLELSH-COBSHVIPSA-N. The full InChI is InChI=1S/C7H15NO3/c1-3-4-5-7(9)6(2)8(10)11/h6-7,9H,3-5H2,1-2H3/t6?,7-/m1/s1.
What are the key properties of (3R)-2-nitroheptan-3-ol?
(3R)-2-nitroheptan-3-ol has a molecular weight of 161.20 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-2-nitroheptan-3-ol is sourced from PubChem (CID 57225952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).