About 2-methylhexyl nitrate
2-methylhexyl nitrate (PubChem CID 14767741) has the molecular formula C7H15NO3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-methylhexyl nitrate.
Molecular Properties
| Compound Name | 2-methylhexyl nitrate |
| PubChem CID | 14767741 |
| Molecular Formula | C7H15NO3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.11 |
| IUPAC Name | 2-methylhexyl nitrate |
| SMILES | CCCCC(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C7H15NO3/c1-3-4-5-7(2)6-11-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | USONGLJUMRQADS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-methylhexyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylhexyl nitrate?
The IUPAC name of 2-methylhexyl nitrate (CID 14767741) is 2-methylhexyl nitrate.
What is the SMILES notation for 2-methylhexyl nitrate?
The canonical SMILES for 2-methylhexyl nitrate is CCCCC(C)CO[N+](=O)[O-].
What is the InChIKey of 2-methylhexyl nitrate?
The InChIKey is USONGLJUMRQADS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO3/c1-3-4-5-7(2)6-11-8(9)10/h7H,3-6H2,1-2H3.
What are the key properties of 2-methylhexyl nitrate?
2-methylhexyl nitrate has a molecular weight of 161.20 g/mol, XLogP of 2.02, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylhexyl nitrate is sourced from PubChem (CID 14767741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).