About 2-nitrobutyl nitrate
2-nitrobutyl nitrate (PubChem CID 54181921) has the molecular formula C4H8N2O5
and a molecular weight of 164.12 g/mol. Its IUPAC name is 2-nitrobutyl nitrate.
Molecular Properties
| Compound Name | 2-nitrobutyl nitrate |
| PubChem CID | 54181921 |
| Molecular Formula | C4H8N2O5 |
| Molecular Weight | 164.12 g/mol |
| Exact Mass | 164.04 |
| IUPAC Name | 2-nitrobutyl nitrate |
| SMILES | CCC(CO[N+](=O)[O-])[N+](=O)[O-] |
| InChI | InChI=1S/C4H8N2O5/c1-2-4(5(7)8)3-11-6(9)10/h4H,2-3H2,1H3 |
| InChIKey | PCKDXZLXBVIGRX-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 95.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.12 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitrobutyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitrobutyl nitrate?
The IUPAC name of 2-nitrobutyl nitrate (CID 54181921) is 2-nitrobutyl nitrate.
What is the SMILES notation for 2-nitrobutyl nitrate?
The canonical SMILES for 2-nitrobutyl nitrate is CCC(CO[N+](=O)[O-])[N+](=O)[O-].
What is the InChIKey of 2-nitrobutyl nitrate?
The InChIKey is PCKDXZLXBVIGRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N2O5/c1-2-4(5(7)8)3-11-6(9)10/h4H,2-3H2,1H3.
What are the key properties of 2-nitrobutyl nitrate?
2-nitrobutyl nitrate has a molecular weight of 164.12 g/mol, XLogP of 0.25, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitrobutyl nitrate is sourced from PubChem (CID 54181921), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).