About acetic acid;2-nitrohexan-3-ol
acetic acid;2-nitrohexan-3-ol (PubChem CID 57348377) has the molecular formula C8H17NO5
and a molecular weight of 207.23 g/mol. Its IUPAC name is acetic acid;2-nitrohexan-3-ol.
Molecular Properties
| Compound Name | acetic acid;2-nitrohexan-3-ol |
| PubChem CID | 57348377 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | acetic acid;2-nitrohexan-3-ol |
| SMILES | CC(=O)O.CCCC(O)C(C)[N+](=O)[O-] |
| InChI | InChI=1S/C6H13NO3.C2H4O2/c1-3-4-6(8)5(2)7(9)10;1-2(3)4/h5-6,8H,3-4H2,1-2H3;1H3,(H,3,4) |
| InChIKey | CVINHTXXBXFPME-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 100.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-nitrohexan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-nitrohexan-3-ol?
The IUPAC name of acetic acid;2-nitrohexan-3-ol (CID 57348377) is acetic acid;2-nitrohexan-3-ol.
What is the SMILES notation for acetic acid;2-nitrohexan-3-ol?
The canonical SMILES for acetic acid;2-nitrohexan-3-ol is CC(=O)O.CCCC(O)C(C)[N+](=O)[O-].
What is the InChIKey of acetic acid;2-nitrohexan-3-ol?
The InChIKey is CVINHTXXBXFPME-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO3.C2H4O2/c1-3-4-6(8)5(2)7(9)10;1-2(3)4/h5-6,8H,3-4H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;2-nitrohexan-3-ol?
acetic acid;2-nitrohexan-3-ol has a molecular weight of 207.23 g/mol, XLogP of 0.90, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-nitrohexan-3-ol is sourced from PubChem (CID 57348377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).