C11H15NO3 — CID 11543020
(1R,2R)-1-nitro-1-phenylpentan-2-ol (PubChem CID 11543020) has the molecular formula C11H15NO3 and a molecular weight of 209.25 g/mol. Its IUPAC name is (1R,2R)-1-nitro-1-phenylpentan-2-ol.
| Compound Name | (1R,2R)-1-nitro-1-phenylpentan-2-ol |
|---|---|
| PubChem CID | 11543020 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | (1R,2R)-1-nitro-1-phenylpentan-2-ol |
| SMILES | CCC[C@@H](O)[C@@H](c1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C11H15NO3/c1-2-6-10(13)11(12(14)15)9-7-4-3-5-8-9/h3-5,7-8,10-11,13H,2,6H2,1H3/t10-,11-/m1/s1 |
| InChIKey | OZXPUESOJUJXEM-GHMZBOCLSA-N |
| XLogP | 2.17 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|