C12H17NO3 — CID 101032365
(3R,4S)-4-nitro-1-phenylhexan-3-ol (PubChem CID 101032365) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (3R,4S)-4-nitro-1-phenylhexan-3-ol.
| Compound Name | (3R,4S)-4-nitro-1-phenylhexan-3-ol |
|---|---|
| PubChem CID | 101032365 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (3R,4S)-4-nitro-1-phenylhexan-3-ol |
| SMILES | CC[C@@H]([C@H](O)CCc1ccccc1)[N+](=O)[O-] |
| InChI | InChI=1S/C12H17NO3/c1-2-11(13(15)16)12(14)9-8-10-6-4-3-5-7-10/h3-7,11-12,14H,2,8-9H2,1H3/t11-,12+/m0/s1 |
| InChIKey | WBXOUMYMGPQEIT-NWDGAFQWSA-N |
| XLogP | 2.04 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|