About benzene;nitro(phenyl)methanol
benzene;nitro(phenyl)methanol (PubChem CID 174698323) has the molecular formula C13H13NO3
and a molecular weight of 231.25 g/mol. Its IUPAC name is benzene;nitro(phenyl)methanol.
Molecular Properties
| Compound Name | benzene;nitro(phenyl)methanol |
| PubChem CID | 174698323 |
| Molecular Formula | C13H13NO3 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | benzene;nitro(phenyl)methanol |
| SMILES | O=[N+]([O-])C(O)c1ccccc1.c1ccccc1 |
| InChI | InChI=1S/C7H7NO3.C6H6/c9-7(8(10)11)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,7,9H;1-6H |
| InChIKey | PUAVHDZVYRRDGR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze benzene;nitro(phenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;nitro(phenyl)methanol?
The IUPAC name of benzene;nitro(phenyl)methanol (CID 174698323) is benzene;nitro(phenyl)methanol.
What is the SMILES notation for benzene;nitro(phenyl)methanol?
The canonical SMILES for benzene;nitro(phenyl)methanol is O=[N+]([O-])C(O)c1ccccc1.c1ccccc1.
What is the InChIKey of benzene;nitro(phenyl)methanol?
The InChIKey is PUAVHDZVYRRDGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO3.C6H6/c9-7(8(10)11)6-4-2-1-3-5-6;1-2-4-6-5-3-1/h1-5,7,9H;1-6H.
What are the key properties of benzene;nitro(phenyl)methanol?
benzene;nitro(phenyl)methanol has a molecular weight of 231.25 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;nitro(phenyl)methanol is sourced from PubChem (CID 174698323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).