C8H9NO4 — CID 101193142
(1S,2S)-1-nitro-2-phenylethane-1,2-diol (PubChem CID 101193142) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is (1S,2S)-1-nitro-2-phenylethane-1,2-diol.
| Compound Name | (1S,2S)-1-nitro-2-phenylethane-1,2-diol |
|---|---|
| PubChem CID | 101193142 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | (1S,2S)-1-nitro-2-phenylethane-1,2-diol |
| SMILES | O=[N+]([O-])[C@@H](O)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C8H9NO4/c10-7(8(11)9(12)13)6-4-2-1-3-5-6/h1-5,7-8,10-11H/t7-,8-/m0/s1 |
| InChIKey | YUPBNNYRBNOGMO-YUMQZZPRSA-N |
| XLogP | 0.32 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|