About nitric acid;1-phenylethanol
nitric acid;1-phenylethanol (PubChem CID 67855225) has the molecular formula C8H11NO4
and a molecular weight of 185.18 g/mol. Its IUPAC name is nitric acid;1-phenylethanol.
Molecular Properties
| Compound Name | nitric acid;1-phenylethanol |
| PubChem CID | 67855225 |
| Molecular Formula | C8H11NO4 |
| Molecular Weight | 185.18 g/mol |
| Exact Mass | 185.07 |
| IUPAC Name | nitric acid;1-phenylethanol |
| SMILES | CC(O)c1ccccc1.O=[N+]([O-])O |
| InChI | InChI=1S/C8H10O.HNO3/c1-7(9)8-5-3-2-4-6-8;2-1(3)4/h2-7,9H,1H3;(H,2,3,4) |
| InChIKey | TVEFYGVGFFCPBW-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.18 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;1-phenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;1-phenylethanol?
The IUPAC name of nitric acid;1-phenylethanol (CID 67855225) is nitric acid;1-phenylethanol.
What is the SMILES notation for nitric acid;1-phenylethanol?
The canonical SMILES for nitric acid;1-phenylethanol is CC(O)c1ccccc1.O=[N+]([O-])O.
What is the InChIKey of nitric acid;1-phenylethanol?
The InChIKey is TVEFYGVGFFCPBW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O.HNO3/c1-7(9)8-5-3-2-4-6-8;2-1(3)4/h2-7,9H,1H3;(H,2,3,4).
What are the key properties of nitric acid;1-phenylethanol?
nitric acid;1-phenylethanol has a molecular weight of 185.18 g/mol, XLogP of 1.39, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;1-phenylethanol is sourced from PubChem (CID 67855225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).