About nitric acid;tetraphenylstibanium
nitric acid;tetraphenylstibanium (PubChem CID 54606514) has the molecular formula C24H21NO3Sb+
and a molecular weight of 493.20 g/mol. Its IUPAC name is nitric acid;tetraphenylstibanium.
Molecular Properties
| Compound Name | nitric acid;tetraphenylstibanium |
| PubChem CID | 54606514 |
| Molecular Formula | C24H21NO3Sb+ |
| Molecular Weight | 493.20 g/mol |
| Exact Mass | 492.06 |
| IUPAC Name | nitric acid;tetraphenylstibanium |
| SMILES | O=[N+]([O-])O.c1ccc([Sb+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/4C6H5.HNO3.Sb/c4*1-2-4-6-5-3-1;2-1(3)4;/h4*1-5H;(H,2,3,4);/q;;;;;+1 |
| InChIKey | YXFSBNNEMAVDEN-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 63.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 493.20 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze nitric acid;tetraphenylstibanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nitric acid;tetraphenylstibanium?
The IUPAC name of nitric acid;tetraphenylstibanium (CID 54606514) is nitric acid;tetraphenylstibanium.
What is the SMILES notation for nitric acid;tetraphenylstibanium?
The canonical SMILES for nitric acid;tetraphenylstibanium is O=[N+]([O-])O.c1ccc([Sb+](c2ccccc2)(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of nitric acid;tetraphenylstibanium?
The InChIKey is YXFSBNNEMAVDEN-UHFFFAOYSA-N. The full InChI is InChI=1S/4C6H5.HNO3.Sb/c4*1-2-4-6-5-3-1;2-1(3)4;/h4*1-5H;(H,2,3,4);/q;;;;;+1.
What are the key properties of nitric acid;tetraphenylstibanium?
nitric acid;tetraphenylstibanium has a molecular weight of 493.20 g/mol, XLogP of 2.72, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for nitric acid;tetraphenylstibanium is sourced from PubChem (CID 54606514), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).