About fluorobenzene;bis(nitric acid)
fluorobenzene;bis(nitric acid) (PubChem CID 88837609) has the molecular formula C6H7FN2O6
and a molecular weight of 222.13 g/mol. Its IUPAC name is fluorobenzene;bis(nitric acid).
Molecular Properties
| Compound Name | fluorobenzene;bis(nitric acid) |
| PubChem CID | 88837609 |
| Molecular Formula | C6H7FN2O6 |
| Molecular Weight | 222.13 g/mol |
| Exact Mass | 222.03 |
| IUPAC Name | fluorobenzene;bis(nitric acid) |
| SMILES | Fc1ccccc1.O=[N+]([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/C6H5F.2HNO3/c7-6-4-2-1-3-5-6;2*2-1(3)4/h1-5H;2*(H,2,3,4) |
| InChIKey | QYBXPGREYOAAMB-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 126.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.13 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;bis(nitric acid) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;bis(nitric acid)?
The IUPAC name of fluorobenzene;bis(nitric acid) (CID 88837609) is fluorobenzene;bis(nitric acid).
What is the SMILES notation for fluorobenzene;bis(nitric acid)?
The canonical SMILES for fluorobenzene;bis(nitric acid) is Fc1ccccc1.O=[N+]([O-])O.O=[N+]([O-])O.
What is the InChIKey of fluorobenzene;bis(nitric acid)?
The InChIKey is QYBXPGREYOAAMB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F.2HNO3/c7-6-4-2-1-3-5-6;2*2-1(3)4/h1-5H;2*(H,2,3,4).
What are the key properties of fluorobenzene;bis(nitric acid)?
fluorobenzene;bis(nitric acid) has a molecular weight of 222.13 g/mol, XLogP of 1.13, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;bis(nitric acid) is sourced from PubChem (CID 88837609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).