About hydrazine;nitric acid;trifluoromethylbenzene
hydrazine;nitric acid;trifluoromethylbenzene (PubChem CID 174887362) has the molecular formula C7H10F3N3O3
and a molecular weight of 241.17 g/mol. Its IUPAC name is hydrazine;nitric acid;trifluoromethylbenzene.
Molecular Properties
| Compound Name | hydrazine;nitric acid;trifluoromethylbenzene |
| PubChem CID | 174887362 |
| Molecular Formula | C7H10F3N3O3 |
| Molecular Weight | 241.17 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | hydrazine;nitric acid;trifluoromethylbenzene |
| SMILES | FC(F)(F)c1ccccc1.NN.O=[N+]([O-])O |
| InChI | InChI=1S/C7H5F3.H4N2.HNO3/c8-7(9,10)6-4-2-1-3-5-6;1-2;2-1(3)4/h1-5H;1-2H2;(H,2,3,4) |
| InChIKey | UIZOZIYFOWOBJM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 115.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.17 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;nitric acid;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;nitric acid;trifluoromethylbenzene?
The IUPAC name of hydrazine;nitric acid;trifluoromethylbenzene (CID 174887362) is hydrazine;nitric acid;trifluoromethylbenzene.
What is the SMILES notation for hydrazine;nitric acid;trifluoromethylbenzene?
The canonical SMILES for hydrazine;nitric acid;trifluoromethylbenzene is FC(F)(F)c1ccccc1.NN.O=[N+]([O-])O.
What is the InChIKey of hydrazine;nitric acid;trifluoromethylbenzene?
The InChIKey is UIZOZIYFOWOBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.H4N2.HNO3/c8-7(9,10)6-4-2-1-3-5-6;1-2;2-1(3)4/h1-5H;1-2H2;(H,2,3,4).
What are the key properties of hydrazine;nitric acid;trifluoromethylbenzene?
hydrazine;nitric acid;trifluoromethylbenzene has a molecular weight of 241.17 g/mol, XLogP of 1.18, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;nitric acid;trifluoromethylbenzene is sourced from PubChem (CID 174887362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).