About 2-methylprop-2-enoic acid;trifluoromethylbenzene
2-methylprop-2-enoic acid;trifluoromethylbenzene (PubChem CID 175145896) has the molecular formula C11H11F3O2
and a molecular weight of 232.20 g/mol. Its IUPAC name is 2-methylprop-2-enoic acid;trifluoromethylbenzene.
Molecular Properties
| Compound Name | 2-methylprop-2-enoic acid;trifluoromethylbenzene |
| PubChem CID | 175145896 |
| Molecular Formula | C11H11F3O2 |
| Molecular Weight | 232.20 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 2-methylprop-2-enoic acid;trifluoromethylbenzene |
| SMILES | C=C(C)C(=O)O.FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C7H5F3.C4H6O2/c8-7(9,10)6-4-2-1-3-5-6;1-3(2)4(5)6/h1-5H;1H2,2H3,(H,5,6) |
| InChIKey | ZCNALYAHYFEIGZ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.20 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylprop-2-enoic acid;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylprop-2-enoic acid;trifluoromethylbenzene?
The IUPAC name of 2-methylprop-2-enoic acid;trifluoromethylbenzene (CID 175145896) is 2-methylprop-2-enoic acid;trifluoromethylbenzene.
What is the SMILES notation for 2-methylprop-2-enoic acid;trifluoromethylbenzene?
The canonical SMILES for 2-methylprop-2-enoic acid;trifluoromethylbenzene is C=C(C)C(=O)O.FC(F)(F)c1ccccc1.
What is the InChIKey of 2-methylprop-2-enoic acid;trifluoromethylbenzene?
The InChIKey is ZCNALYAHYFEIGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.C4H6O2/c8-7(9,10)6-4-2-1-3-5-6;1-3(2)4(5)6/h1-5H;1H2,2H3,(H,5,6).
What are the key properties of 2-methylprop-2-enoic acid;trifluoromethylbenzene?
2-methylprop-2-enoic acid;trifluoromethylbenzene has a molecular weight of 232.20 g/mol, XLogP of 3.35, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylprop-2-enoic acid;trifluoromethylbenzene is sourced from PubChem (CID 175145896), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).