C23H16F6O — CID 59226926
1-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]propan-2-one (PubChem CID 59226926) has the molecular formula C23H16F6O and a molecular weight of 422.37 g/mol. Its IUPAC name is 1-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]propan-2-one.
| Compound Name | 1-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 59226926 |
| Molecular Formula | C23H16F6O |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.11 |
| IUPAC Name | 1-phenyl-1,1-bis[4-(trifluoromethyl)phenyl]propan-2-one |
| SMILES | CC(=O)C(c1ccccc1)(c1ccc(C(F)(F)F)cc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H16F6O/c1-15(30)21(16-5-3-2-4-6-16,17-7-11-19(12-8-17)22(24,25)26)18-9-13-20(14-10-18)23(27,28)29/h2-14H,1H3 |
| InChIKey | PGGGSGNYGIVENI-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|