C21H14F3NO2 — CID 162534891
1-(1-nitro-2,2-diphenylethenyl)-4-(trifluoromethyl)benzene (PubChem CID 162534891) has the molecular formula C21H14F3NO2 and a molecular weight of 369.34 g/mol. Its IUPAC name is 1-(1-nitro-2,2-diphenylethenyl)-4-(trifluoromethyl)benzene.
| Compound Name | 1-(1-nitro-2,2-diphenylethenyl)-4-(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 162534891 |
| Molecular Formula | C21H14F3NO2 |
| Molecular Weight | 369.34 g/mol |
| Exact Mass | 369.10 |
| IUPAC Name | 1-(1-nitro-2,2-diphenylethenyl)-4-(trifluoromethyl)benzene |
| SMILES | O=[N+]([O-])C(=C(c1ccccc1)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C21H14F3NO2/c22-21(23,24)18-13-11-17(12-14-18)20(25(26)27)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-14H |
| InChIKey | MJUQWHTVGYDALO-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 43.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.34 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|