C23H19F3N2O5 — CID 174481401
(3-methyl-4-nitrophenyl)-phenylmethanone;[4-(trifluoromethyl)phenyl]methylcarbamic acid (PubChem CID 174481401) has the molecular formula C23H19F3N2O5 and a molecular weight of 460.41 g/mol. Its IUPAC name is (3-methyl-4-nitrophenyl)-phenylmethanone;[4-(trifluoromethyl)phenyl]methylcarbamic acid.
| Compound Name | (3-methyl-4-nitrophenyl)-phenylmethanone;[4-(trifluoromethyl)phenyl]methylcarbamic acid |
|---|---|
| PubChem CID | 174481401 |
| Molecular Formula | C23H19F3N2O5 |
| Molecular Weight | 460.41 g/mol |
| Exact Mass | 460.12 |
| IUPAC Name | (3-methyl-4-nitrophenyl)-phenylmethanone;[4-(trifluoromethyl)phenyl]methylcarbamic acid |
| SMILES | Cc1cc(C(=O)c2ccccc2)ccc1[N+](=O)[O-].O=C(O)NCc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H11NO3.C9H8F3NO2/c1-10-9-12(7-8-13(10)15(17)18)14(16)11-5-3-2-4-6-11;10-9(11,12)7-3-1-6(2-4-7)5-13-8(14)15/h2-9H,1H3;1-4,13H,5H2,(H,14,15) |
| InChIKey | VCNLTDAPMROXGV-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 109.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.41 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|