C22H17N3O3S — CID 3935522
N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3-methyl-4-nitrobenzamide (PubChem CID 3935522) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 3935522 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | N-[[4-(1,3-benzothiazol-2-yl)phenyl]methyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCc2ccc(-c3nc4ccccc4s3)cc2)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C22H17N3O3S/c1-14-12-17(10-11-19(14)25(27)28)21(26)23-13-15-6-8-16(9-7-15)22-24-18-4-2-3-5-20(18)29-22/h2-12H,13H2,1H3,(H,23,26) |
| InChIKey | QCZXIBGEOZQWBK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|