C26H24N4O3S — CID 108738372
4-(dimethylamino)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-nitrobenzamide (PubChem CID 108738372) has the molecular formula C26H24N4O3S and a molecular weight of 472.57 g/mol. Its IUPAC name is 4-(dimethylamino)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-nitrobenzamide.
| Compound Name | 4-(dimethylamino)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 108738372 |
| Molecular Formula | C26H24N4O3S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | 4-(dimethylamino)-N-[[4-[4-(4-methylphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-nitrobenzamide |
| SMILES | Cc1ccc(-c2csc(-c3ccc(CNC(=O)c4ccc(N(C)C)c([N+](=O)[O-])c4)cc3)n2)cc1 |
| InChI | InChI=1S/C26H24N4O3S/c1-17-4-8-19(9-5-17)22-16-34-26(28-22)20-10-6-18(7-11-20)15-27-25(31)21-12-13-23(29(2)3)24(14-21)30(32)33/h4-14,16H,15H2,1-3H3,(H,27,31) |
| InChIKey | VQGMXAPTOMJWAO-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 88.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|