C26H23N3O5S — CID 108725343
N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-methyl-4-nitrobenzamide (PubChem CID 108725343) has the molecular formula C26H23N3O5S and a molecular weight of 489.55 g/mol. Its IUPAC name is N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 108725343 |
| Molecular Formula | C26H23N3O5S |
| Molecular Weight | 489.55 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | N-[[4-[4-(3,4-dimethoxyphenyl)-1,3-thiazol-2-yl]phenyl]methyl]-3-methyl-4-nitrobenzamide |
| SMILES | COc1ccc(-c2csc(-c3ccc(CNC(=O)c4ccc([N+](=O)[O-])c(C)c4)cc3)n2)cc1OC |
| InChI | InChI=1S/C26H23N3O5S/c1-16-12-20(8-10-22(16)29(31)32)25(30)27-14-17-4-6-18(7-5-17)26-28-21(15-35-26)19-9-11-23(33-2)24(13-19)34-3/h4-13,15H,14H2,1-3H3,(H,27,30) |
| InChIKey | GJDGYUZUJZHMHW-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|