C20H19N3O5S — CID 54773773
3,4-dimethoxy-N-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]ethyl]benzamide (PubChem CID 54773773) has the molecular formula C20H19N3O5S and a molecular weight of 413.46 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]ethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 54773773 |
| Molecular Formula | C20H19N3O5S |
| Molecular Weight | 413.46 g/mol |
| Exact Mass | 413.10 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[4-(4-nitrophenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCCc2nc(-c3ccc([N+](=O)[O-])cc3)cs2)cc1OC |
| InChI | InChI=1S/C20H19N3O5S/c1-27-17-8-5-14(11-18(17)28-2)20(24)21-10-9-19-22-16(12-29-19)13-3-6-15(7-4-13)23(25)26/h3-8,11-12H,9-10H2,1-2H3,(H,21,24) |
| InChIKey | PUUCUVWGQFAUSN-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 103.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.46 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|