C18H15FN2O2S — CID 110393547
4-fluoro-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide (PubChem CID 110393547) has the molecular formula C18H15FN2O2S and a molecular weight of 342.40 g/mol. Its IUPAC name is 4-fluoro-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide.
| Compound Name | 4-fluoro-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
|---|---|
| PubChem CID | 110393547 |
| Molecular Formula | C18H15FN2O2S |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 4-fluoro-N-[2-[4-(4-hydroxyphenyl)-1,3-thiazol-2-yl]ethyl]benzamide |
| SMILES | O=C(NCCc1nc(-c2ccc(O)cc2)cs1)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H15FN2O2S/c19-14-5-1-13(2-6-14)18(23)20-10-9-17-21-16(11-24-17)12-3-7-15(22)8-4-12/h1-8,11,22H,9-10H2,(H,20,23) |
| InChIKey | WTIFBTYWGLBUKF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |