C13H12FNO2S — CID 94276835
methyl 3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanoate (PubChem CID 94276835) has the molecular formula C13H12FNO2S and a molecular weight of 265.31 g/mol. Its IUPAC name is methyl 3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanoate.
| Compound Name | methyl 3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanoate |
|---|---|
| PubChem CID | 94276835 |
| Molecular Formula | C13H12FNO2S |
| Molecular Weight | 265.31 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl 3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanoate |
| SMILES | COC(=O)CCc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C13H12FNO2S/c1-17-13(16)7-6-12-15-11(8-18-12)9-2-4-10(14)5-3-9/h2-5,8H,6-7H2,1H3 |
| InChIKey | CGRKWWJNOBLWTA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.31 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |