C18H22FN3O2S — CID 110609845
N-(4-acetamidobutyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide (PubChem CID 110609845) has the molecular formula C18H22FN3O2S and a molecular weight of 363.46 g/mol. Its IUPAC name is N-(4-acetamidobutyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide.
| Compound Name | N-(4-acetamidobutyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
|---|---|
| PubChem CID | 110609845 |
| Molecular Formula | C18H22FN3O2S |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | N-(4-acetamidobutyl)-3-[4-(4-fluorophenyl)-1,3-thiazol-2-yl]propanamide |
| SMILES | CC(=O)NCCCCNC(=O)CCc1nc(-c2ccc(F)cc2)cs1 |
| InChI | InChI=1S/C18H22FN3O2S/c1-13(23)20-10-2-3-11-21-17(24)8-9-18-22-16(12-25-18)14-4-6-15(19)7-5-14/h4-7,12H,2-3,8-11H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | LFPBFTNFLHCVLK-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|