C15H19N3OS — CID 110317749
N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]pentanamide (PubChem CID 110317749) has the molecular formula C15H19N3OS and a molecular weight of 289.40 g/mol. Its IUPAC name is N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]pentanamide.
| Compound Name | N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]pentanamide |
|---|---|
| PubChem CID | 110317749 |
| Molecular Formula | C15H19N3OS |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.12 |
| IUPAC Name | N-[2-(4-pyridin-4-yl-1,3-thiazol-2-yl)ethyl]pentanamide |
| SMILES | CCCCC(=O)NCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C15H19N3OS/c1-2-3-4-14(19)17-10-7-15-18-13(11-20-15)12-5-8-16-9-6-12/h5-6,8-9,11H,2-4,7,10H2,1H3,(H,17,19) |
| InChIKey | NYRVMSMXQHXBAT-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |