C15H22Cl2N4OS — CID 119875531
4-amino-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride (PubChem CID 119875531) has the molecular formula C15H22Cl2N4OS and a molecular weight of 377.34 g/mol. Its IUPAC name is 4-amino-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride.
| Compound Name | 4-amino-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119875531 |
| Molecular Formula | C15H22Cl2N4OS |
| Molecular Weight | 377.34 g/mol |
| Exact Mass | 376.09 |
| IUPAC Name | 4-amino-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]butanamide;dihydrochloride |
| SMILES | Cl.Cl.NCCCC(=O)NCCCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C15H20N4OS.2ClH/c16-7-1-3-14(20)18-8-2-4-15-19-13(11-21-15)12-5-9-17-10-6-12;;/h5-6,9-11H,1-4,7-8,16H2,(H,18,20);2*1H |
| InChIKey | WIPYVXJZNWDOKN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.34 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|