C20H24Cl2N4OS — CID 119953650
3-amino-3-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide;dihydrochloride (PubChem CID 119953650) has the molecular formula C20H24Cl2N4OS and a molecular weight of 439.41 g/mol. Its IUPAC name is 3-amino-3-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide;dihydrochloride.
| Compound Name | 3-amino-3-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 119953650 |
| Molecular Formula | C20H24Cl2N4OS |
| Molecular Weight | 439.41 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | 3-amino-3-phenyl-N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]propanamide;dihydrochloride |
| SMILES | Cl.Cl.NC(CC(=O)NCCCc1nc(-c2ccncc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H22N4OS.2ClH/c21-17(15-5-2-1-3-6-15)13-19(25)23-10-4-7-20-24-18(14-26-20)16-8-11-22-12-9-16;;/h1-3,5-6,8-9,11-12,14,17H,4,7,10,13,21H2,(H,23,25);2*1H |
| InChIKey | SVGQFQJOSNUBGZ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.41 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|