C22H22F3N3OS — CID 56520412
N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 56520412) has the molecular formula C22H22F3N3OS and a molecular weight of 433.50 g/mol. Its IUPAC name is N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 56520412 |
| Molecular Formula | C22H22F3N3OS |
| Molecular Weight | 433.50 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N-[3-(4-pyridin-4-yl-1,3-thiazol-2-yl)propyl]-3-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | CC(CC(=O)NCCCc1nc(-c2ccncc2)cs1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H22F3N3OS/c1-15(16-4-6-18(7-5-16)22(23,24)25)13-20(29)27-10-2-3-21-28-19(14-30-21)17-8-11-26-12-9-17/h4-9,11-12,14-15H,2-3,10,13H2,1H3,(H,27,29) |
| InChIKey | VBVRPLYNPSSJGS-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.50 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|