C15H19F3N2O2 — CID 94676198
(3R)-N-(4-amino-4-oxobutyl)-3-[4-(trifluoromethyl)phenyl]butanamide (PubChem CID 94676198) has the molecular formula C15H19F3N2O2 and a molecular weight of 316.32 g/mol. Its IUPAC name is (3R)-N-(4-amino-4-oxobutyl)-3-[4-(trifluoromethyl)phenyl]butanamide.
| Compound Name | (3R)-N-(4-amino-4-oxobutyl)-3-[4-(trifluoromethyl)phenyl]butanamide |
|---|---|
| PubChem CID | 94676198 |
| Molecular Formula | C15H19F3N2O2 |
| Molecular Weight | 316.32 g/mol |
| Exact Mass | 316.14 |
| IUPAC Name | (3R)-N-(4-amino-4-oxobutyl)-3-[4-(trifluoromethyl)phenyl]butanamide |
| SMILES | C[C@H](CC(=O)NCCCC(N)=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H19F3N2O2/c1-10(9-14(22)20-8-2-3-13(19)21)11-4-6-12(7-5-11)15(16,17)18/h4-7,10H,2-3,8-9H2,1H3,(H2,19,21)(H,20,22)/t10-/m1/s1 |
| InChIKey | HRRIDOKCKGOVHN-SNVBAGLBSA-N |
| XLogP | 2.58 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.32 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|