C18H25F3N2O3 — CID 71685048
tert-butyl N-[2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]ethyl]carbamate (PubChem CID 71685048) has the molecular formula C18H25F3N2O3 and a molecular weight of 374.40 g/mol. Its IUPAC name is tert-butyl N-[2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 71685048 |
| Molecular Formula | C18H25F3N2O3 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | tert-butyl N-[2-[3-[4-(trifluoromethyl)phenyl]butanoylamino]ethyl]carbamate |
| SMILES | CC(CC(=O)NCCNC(=O)OC(C)(C)C)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H25F3N2O3/c1-12(13-5-7-14(8-6-13)18(19,20)21)11-15(24)22-9-10-23-16(25)26-17(2,3)4/h5-8,12H,9-11H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | LDRUFZYLVAEVKQ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|