C19H20F3N3O3 — CID 9277077
(3S)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3-phenylbutanamide (PubChem CID 9277077) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is (3S)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3-phenylbutanamide.
| Compound Name | (3S)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3-phenylbutanamide |
|---|---|
| PubChem CID | 9277077 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (3S)-N-[2-[2-nitro-4-(trifluoromethyl)anilino]ethyl]-3-phenylbutanamide |
| SMILES | C[C@@H](CC(=O)NCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])c1ccccc1 |
| InChI | InChI=1S/C19H20F3N3O3/c1-13(14-5-3-2-4-6-14)11-18(26)24-10-9-23-16-8-7-15(19(20,21)22)12-17(16)25(27)28/h2-8,12-13,23H,9-11H2,1H3,(H,24,26)/t13-/m0/s1 |
| InChIKey | LZDFCLGIYIYXLJ-ZDUSSCGKSA-N |
| XLogP | 4.34 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|