C14H20ClF3N4O3 — CID 119506796
N-[2-(ethylamino)ethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride (PubChem CID 119506796) has the molecular formula C14H20ClF3N4O3 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[2-(ethylamino)ethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride.
| Compound Name | N-[2-(ethylamino)ethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride |
|---|---|
| PubChem CID | 119506796 |
| Molecular Formula | C14H20ClF3N4O3 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | N-[2-(ethylamino)ethyl]-3-[2-nitro-4-(trifluoromethyl)anilino]propanamide;hydrochloride |
| SMILES | CCNCCNC(=O)CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C14H19F3N4O3.ClH/c1-2-18-7-8-20-13(22)5-6-19-11-4-3-10(14(15,16)17)9-12(11)21(23)24;/h3-4,9,18-19H,2,5-8H2,1H3,(H,20,22);1H |
| InChIKey | BBFFUVZYIIAHDS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|