C12H16F3N3O2 — CID 61020235
N-ethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine (PubChem CID 61020235) has the molecular formula C12H16F3N3O2 and a molecular weight of 291.27 g/mol. Its IUPAC name is N-ethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine.
| Compound Name | N-ethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 61020235 |
| Molecular Formula | C12H16F3N3O2 |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | N-ethyl-N'-[2-nitro-4-(trifluoromethyl)phenyl]propane-1,3-diamine |
| SMILES | CCNCCCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H16F3N3O2/c1-2-16-6-3-7-17-10-5-4-9(12(13,14)15)8-11(10)18(19)20/h4-5,8,16-17H,2-3,6-7H2,1H3 |
| InChIKey | RQQBJCGNEVQVLS-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|