C11H15FIN3O2 — CID 66100467
N-ethyl-N'-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,3-diamine (PubChem CID 66100467) has the molecular formula C11H15FIN3O2 and a molecular weight of 367.16 g/mol. Its IUPAC name is N-ethyl-N'-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 66100467 |
| Molecular Formula | C11H15FIN3O2 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 367.02 |
| IUPAC Name | N-ethyl-N'-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,3-diamine |
| SMILES | CCNCCCNc1cc(F)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15FIN3O2/c1-2-14-4-3-5-15-10-6-8(12)9(13)7-11(10)16(17)18/h6-7,14-15H,2-5H2,1H3 |
| InChIKey | LUKIJMBOGLXJBH-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|