C11H16FN3O2 — CID 54906818
N-ethyl-N'-(2-fluoro-4-nitrophenyl)propane-1,3-diamine (PubChem CID 54906818) has the molecular formula C11H16FN3O2 and a molecular weight of 241.27 g/mol. Its IUPAC name is N-ethyl-N'-(2-fluoro-4-nitrophenyl)propane-1,3-diamine.
| Compound Name | N-ethyl-N'-(2-fluoro-4-nitrophenyl)propane-1,3-diamine |
|---|---|
| PubChem CID | 54906818 |
| Molecular Formula | C11H16FN3O2 |
| Molecular Weight | 241.27 g/mol |
| Exact Mass | 241.12 |
| IUPAC Name | N-ethyl-N'-(2-fluoro-4-nitrophenyl)propane-1,3-diamine |
| SMILES | CCNCCCNc1ccc([N+](=O)[O-])cc1F |
| InChI | InChI=1S/C11H16FN3O2/c1-2-13-6-3-7-14-11-5-4-9(15(16)17)8-10(11)12/h4-5,8,13-14H,2-3,6-7H2,1H3 |
| InChIKey | XNLTYAZXAGAGJP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 67.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.27 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|