C9H11FIN3O2 — CID 66100865
1-N-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,2-diamine (PubChem CID 66100865) has the molecular formula C9H11FIN3O2 and a molecular weight of 339.11 g/mol. Its IUPAC name is 1-N-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,2-diamine.
| Compound Name | 1-N-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,2-diamine |
|---|---|
| PubChem CID | 66100865 |
| Molecular Formula | C9H11FIN3O2 |
| Molecular Weight | 339.11 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 1-N-(5-fluoro-4-iodo-2-nitrophenyl)propane-1,2-diamine |
| SMILES | CC(N)CNc1cc(F)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H11FIN3O2/c1-5(12)4-13-8-2-6(10)7(11)3-9(8)14(15)16/h2-3,5,13H,4,12H2,1H3 |
| InChIKey | WFGSMLZMCTUPKK-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.11 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|