C8H9FIN3O2 — CID 66086750
N'-(5-fluoro-4-iodo-2-nitrophenyl)ethane-1,2-diamine (PubChem CID 66086750) has the molecular formula C8H9FIN3O2 and a molecular weight of 325.08 g/mol. Its IUPAC name is N'-(5-fluoro-4-iodo-2-nitrophenyl)ethane-1,2-diamine.
| Compound Name | N'-(5-fluoro-4-iodo-2-nitrophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 66086750 |
| Molecular Formula | C8H9FIN3O2 |
| Molecular Weight | 325.08 g/mol |
| Exact Mass | 324.97 |
| IUPAC Name | N'-(5-fluoro-4-iodo-2-nitrophenyl)ethane-1,2-diamine |
| SMILES | NCCNc1cc(F)c(I)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H9FIN3O2/c9-5-3-7(12-2-1-11)8(13(14)15)4-6(5)10/h3-4,12H,1-2,11H2 |
| InChIKey | BWNCPIUFHKBUGX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|