C16H22ClF3N4O3 — CID 119535554
3-[2-nitro-4-(trifluoromethyl)anilino]-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride (PubChem CID 119535554) has the molecular formula C16H22ClF3N4O3 and a molecular weight of 410.82 g/mol. Its IUPAC name is 3-[2-nitro-4-(trifluoromethyl)anilino]-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride.
| Compound Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride |
|---|---|
| PubChem CID | 119535554 |
| Molecular Formula | C16H22ClF3N4O3 |
| Molecular Weight | 410.82 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-[2-nitro-4-(trifluoromethyl)anilino]-N-(2-pyrrolidin-3-ylethyl)propanamide;hydrochloride |
| SMILES | Cl.O=C(CCNc1ccc(C(F)(F)F)cc1[N+](=O)[O-])NCCC1CCNC1 |
| InChI | InChI=1S/C16H21F3N4O3.ClH/c17-16(18,19)12-1-2-13(14(9-12)23(25)26)21-8-5-15(24)22-7-4-11-3-6-20-10-11;/h1-2,9,11,20-21H,3-8,10H2,(H,22,24);1H |
| InChIKey | VJBZQPIGACFKOC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.82 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|