C16H23ClN4O3 — CID 119534894
4-(cyclopropylamino)-3-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide;hydrochloride (PubChem CID 119534894) has the molecular formula C16H23ClN4O3 and a molecular weight of 354.84 g/mol. Its IUPAC name is 4-(cyclopropylamino)-3-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide;hydrochloride.
| Compound Name | 4-(cyclopropylamino)-3-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119534894 |
| Molecular Formula | C16H23ClN4O3 |
| Molecular Weight | 354.84 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | 4-(cyclopropylamino)-3-nitro-N-(2-pyrrolidin-3-ylethyl)benzamide;hydrochloride |
| SMILES | Cl.O=C(NCCC1CCNC1)c1ccc(NC2CC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H22N4O3.ClH/c21-16(18-8-6-11-5-7-17-10-11)12-1-4-14(19-13-2-3-13)15(9-12)20(22)23;/h1,4,9,11,13,17,19H,2-3,5-8,10H2,(H,18,21);1H |
| InChIKey | DKJYJRPULDJQKE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.84 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|