C12H16N4O4 — CID 63622156
2,4-dinitro-N-(2-pyrrolidin-3-ylethyl)aniline (PubChem CID 63622156) has the molecular formula C12H16N4O4 and a molecular weight of 280.28 g/mol. Its IUPAC name is 2,4-dinitro-N-(2-pyrrolidin-3-ylethyl)aniline.
| Compound Name | 2,4-dinitro-N-(2-pyrrolidin-3-ylethyl)aniline |
|---|---|
| PubChem CID | 63622156 |
| Molecular Formula | C12H16N4O4 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | 2,4-dinitro-N-(2-pyrrolidin-3-ylethyl)aniline |
| SMILES | O=[N+]([O-])c1ccc(NCCC2CCNC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C12H16N4O4/c17-15(18)10-1-2-11(12(7-10)16(19)20)14-6-4-9-3-5-13-8-9/h1-2,7,9,13-14H,3-6,8H2 |
| InChIKey | MLZROTHQECAERE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 110.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|